CAS 15199-43-6 appears in our catalog under these names: Salicylic Acid Impurity 12-d6 (Dimethyl Sulfate-d6), Dimethyl sulfate–d?, Dimethyl sulfate-d6, Dimethyl-d6 sulfate, for NMR, 99+ atom % D, DIMETHYL-D6 SULFATE, 99+ ATOM % D. Offered by: Chemat Brand, GLPBio, Biosynth, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: on request, 1g, 5g, 100mg, 250mg, 500mg, 10G.
Bis(trideuteriomethyl) sulfate (CAS 15199-43-6) is a chemical compound with the molecular formula C2H6O4S and a molecular weight of 132.17 g/mol. IUPAC name: bis(trideuteriomethyl) sulfate. InChIKey: VAYGXNSJCAHWJZ-WFGJKAKNSA-N.
| Molecular formula | C2H6O4S |
|---|---|
| Molecular weight | 132.17 g/mol |
| IUPAC name | bis(trideuteriomethyl) sulfate |
| InChIKey | VAYGXNSJCAHWJZ-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OS(=O)(=O)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)