CAS 1519955-82-8 appears in our catalog under these names: 3-(3,5-Difluorophenyl)cyclobutan-1-ol, 95%, 3-(3,5-Difluorophenyl)cyclobutan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-(3,5-difluorophenyl)cyclobutan-1-ol (CAS 1519955-82-8) is a chemical compound with the molecular formula C10H10F2O and a molecular weight of 184.18 g/mol. IUPAC name: 3-(3,5-difluorophenyl)cyclobutan-1-ol. InChIKey: QMFASIJNNHUHHD-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O |
|---|---|
| Molecular weight | 184.18 g/mol |
| IUPAC name | 3-(3,5-difluorophenyl)cyclobutan-1-ol |
| InChIKey | QMFASIJNNHUHHD-UHFFFAOYSA-N |
| SMILES | C1C(CC1O)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)