Products 1520083-61-7
CAS 1520083-61-7 is the registry number for HX1. Offered by: MedChemExpress. Available pack sizes: 5 mg, 100 mg, 25 mg, 10 mg, 50 mg.
2-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-N-hydroxy-6-oxo-1H-pyrimidine-5-carboxamide (CAS 1520083-61-7) is a chemical compound with the molecular formula C14H10F6N4O3 and a molecular weight of 396.24 g/mol. IUPAC name: 2-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-N-hydroxy-6-oxo-1H-pyrimidine-5-carboxamide. InChIKey: FNNKXGWDBVPDKY-UHFFFAOYSA-N.
| Molecular formula | C14H10F6N4O3 |
|---|---|
| Molecular weight | 396.24 g/mol |
| IUPAC name | 2-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-N-hydroxy-6-oxo-1H-pyrimidine-5-carboxamide |
| InChIKey | FNNKXGWDBVPDKY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CNC2=NC=C(C(=O)N2)C(=O)NO |
Computed by PubChem (NCBI)