CAS 1520470-73-8 appears in our catalog under these names: 4-Bromo-2,5-dimethylthiophene-3-sulfonyl chloride, 95%, 4-Bromo-2,5-dimethylthiophene-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-bromo-2,5-dimethylthiophene-3-sulfonyl chloride (CAS 1520470-73-8) is a chemical compound with the molecular formula C6H6BrClO2S2 and a molecular weight of 289.6 g/mol. IUPAC name: 4-bromo-2,5-dimethylthiophene-3-sulfonyl chloride. InChIKey: LUNIRDJAHKLVGG-UHFFFAOYSA-N.
| Molecular formula | C6H6BrClO2S2 |
|---|---|
| Molecular weight | 289.6 g/mol |
| IUPAC name | 4-bromo-2,5-dimethylthiophene-3-sulfonyl chloride |
| InChIKey | LUNIRDJAHKLVGG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(S1)C)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)