CAS 15208-43-2 is the registry number for 2-(Difluoromethyl)benzo[d]thiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(difluoromethyl)-1,3-benzothiazole (CAS 15208-43-2) is a chemical compound with the molecular formula C8H5F2NS and a molecular weight of 185.20 g/mol. IUPAC name: 2-(difluoromethyl)-1,3-benzothiazole. InChIKey: VEWWMGMQZKGYPP-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NS |
|---|---|
| Molecular weight | 185.20 g/mol |
| IUPAC name | 2-(difluoromethyl)-1,3-benzothiazole |
| InChIKey | VEWWMGMQZKGYPP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C(F)F |
Computed by PubChem (NCBI)