CAS 1520914-79-7 is the registry number for 3-(4-Fluoro-3-methylphenoxy)-2,2-dimethylpropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(4-fluoro-3-methylphenoxy)-2,2-dimethylpropanoic acid (CAS 1520914-79-7) is a chemical compound with the molecular formula C12H15FO3 and a molecular weight of 226.24 g/mol. IUPAC name: 3-(4-fluoro-3-methylphenoxy)-2,2-dimethylpropanoic acid. InChIKey: HZWMJZQFEFWVPQ-UHFFFAOYSA-N.
| Molecular formula | C12H15FO3 |
|---|---|
| Molecular weight | 226.24 g/mol |
| IUPAC name | 3-(4-fluoro-3-methylphenoxy)-2,2-dimethylpropanoic acid |
| InChIKey | HZWMJZQFEFWVPQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OCC(C)(C)C(=O)O)F |
Computed by PubChem (NCBI)