CAS 152095-12-0 appears in our catalog under these names: Dp44mt, 95%, Iron Chelator, Dp44mT, Dp44mT, Dp44mT , Dp44mT, 98.0%. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 100mg, 250mg, 10mg, 25mg, 50mg, 200mg, 10mM (in 1ml dmso).
3-(dipyridin-2-ylmethylideneamino)-1,1-dimethylthiourea (CAS 152095-12-0) is a chemical compound with the molecular formula C14H15N5S and a molecular weight of 285.37 g/mol. IUPAC name: 3-(dipyridin-2-ylmethylideneamino)-1,1-dimethylthiourea. InChIKey: XOBIGRNRXCAMJQ-UHFFFAOYSA-N.
| Molecular formula | C14H15N5S |
|---|---|
| Molecular weight | 285.37 g/mol |
| IUPAC name | 3-(dipyridin-2-ylmethylideneamino)-1,1-dimethylthiourea |
| InChIKey | XOBIGRNRXCAMJQ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=S)NN=C(C1=CC=CC=N1)C2=CC=CC=N2 |
Computed by PubChem (NCBI)