Products 1521197-43-2
CAS 1521197-43-2 is the registry number for 2–Chloro–11–cyclopentyl–5H–benzo(e)pyrimido(5，4–b)(1，4)diazepin–6(11H)–one. Offered by: GLPBio. Available pack sizes: 5mg.
2-chloro-11-cyclopentyl-5H-pyrimido[4,5-b][1,4]benzodiazepin-6-one (CAS 1521197-43-2) is a chemical compound with the molecular formula C16H15ClN4O and a molecular weight of 314.77 g/mol. IUPAC name: 2-chloro-11-cyclopentyl-5H-pyrimido[4,5-b][1,4]benzodiazepin-6-one. InChIKey: WXQUOJFYZDJTSU-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN4O |
|---|---|
| Molecular weight | 314.77 g/mol |
| IUPAC name | 2-chloro-11-cyclopentyl-5H-pyrimido[4,5-b][1,4]benzodiazepin-6-one |
| InChIKey | WXQUOJFYZDJTSU-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N2C3=CC=CC=C3C(=O)NC4=CN=C(N=C42)Cl |
Computed by PubChem (NCBI)