Products 152121-19-2
CAS 152121-19-2 is the registry number for Glucagon receptor antagonist-11. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[4-(4-fluorophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]benzonitrile (CAS 152121-19-2) is a chemical compound with the molecular formula C21H13FN4 and a molecular weight of 340.4 g/mol. IUPAC name: 4-[4-(4-fluorophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]benzonitrile. InChIKey: UTJPXFUHWFHNCZ-UHFFFAOYSA-N.
| Molecular formula | C21H13FN4 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 4-[4-(4-fluorophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]benzonitrile |
| InChIKey | UTJPXFUHWFHNCZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=NC(=C(N2)C3=CC=NC=C3)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)