CAS 152121-41-0 appears in our catalog under these names: 1-(4-Fluorophenyl)-2-(4-pyridinyl)-1,2-ethanedione, 95-<97%, 1–(4–Fluorophenyl)–2–(4–pyridinyl)–1,2–ethanedione, 1-(4-Fluorophenyl)-2-(4-pyridinyl)-1,2-ethanedione 95%, 1-(4-Fluorophenyl)-2-(4-pyridinyl)-1,2-ethanedione, 96%, 96%, 1-(4-Fluorophenyl)-2-(4-pyridinyl)-1,2-ethanedione, 98%. Offered by: Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100mg, 250mg, 1g.
1-(4-fluorophenyl)-2-pyridin-4-ylethane-1,2-dione (CAS 152121-41-0) is a chemical compound with the molecular formula C13H8FNO2 and a molecular weight of 229.21 g/mol. IUPAC name: 1-(4-fluorophenyl)-2-pyridin-4-ylethane-1,2-dione. InChIKey: PWXKRICWMZJIJO-UHFFFAOYSA-N.
| Molecular formula | C13H8FNO2 |
|---|---|
| Molecular weight | 229.21 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-2-pyridin-4-ylethane-1,2-dione |
| InChIKey | PWXKRICWMZJIJO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(=O)C2=CC=NC=C2)F |
Computed by PubChem (NCBI)