Products 152121-61-4
CAS 152121-61-4 is the registry number for Glucagon receptor antagonist-9. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[4-(4-fluorophenyl)-2-(4-methoxyphenyl)-1H-imidazol-5-yl]pyridine (CAS 152121-61-4) is a chemical compound with the molecular formula C21H16FN3O and a molecular weight of 345.4 g/mol. IUPAC name: 4-[4-(4-fluorophenyl)-2-(4-methoxyphenyl)-1H-imidazol-5-yl]pyridine. InChIKey: XBOAMGVRMOKHNU-UHFFFAOYSA-N.
| Molecular formula | C21H16FN3O |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | 4-[4-(4-fluorophenyl)-2-(4-methoxyphenyl)-1H-imidazol-5-yl]pyridine |
| InChIKey | XBOAMGVRMOKHNU-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC(=C(N2)C3=CC=NC=C3)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)