Products 1521521-97-0
CAS 1521521-97-0 is the registry number for 2-Cyclopentyl-1,3,5-trifluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
2-cyclopentyl-1,3,5-trifluorobenzene (CAS 1521521-97-0) is a chemical compound with the molecular formula C11H11F3 and a molecular weight of 200.20 g/mol. IUPAC name: 2-cyclopentyl-1,3,5-trifluorobenzene. InChIKey: CDVZYIHZGWECGZ-UHFFFAOYSA-N.
| Molecular formula | C11H11F3 |
|---|---|
| Molecular weight | 200.20 g/mol |
| IUPAC name | 2-cyclopentyl-1,3,5-trifluorobenzene |
| InChIKey | CDVZYIHZGWECGZ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C2=C(C=C(C=C2F)F)F |
Computed by PubChem (NCBI)