CAS 15216-02-1 is the registry number for Mercaptoethyl)trimethylammonium Iodide. Offered by: TRC. Available pack sizes: 100mg.
Trimethyl-[2-[4-oxo-4-[2-(trimethylazaniumyl)ethylsulfanyl]butanoyl]sulfanylethyl]azanium diiodide (CAS 15216-02-1) is a chemical compound with the molecular formula C14H30I2N2O2S2 and a molecular weight of 576.3 g/mol. IUPAC name: trimethyl-[2-[4-oxo-4-[2-(trimethylazaniumyl)ethylsulfanyl]butanoyl]sulfanylethyl]azanium diiodide. InChIKey: KPSFUYQCEWZPTB-UHFFFAOYSA-L.
| Molecular formula | C14H30I2N2O2S2 |
|---|---|
| Molecular weight | 576.3 g/mol |
| IUPAC name | trimethyl-[2-[4-oxo-4-[2-(trimethylazaniumyl)ethylsulfanyl]butanoyl]sulfanylethyl]azanium diiodide |
| InChIKey | KPSFUYQCEWZPTB-UHFFFAOYSA-L |
| SMILES | C[N+](C)(C)CCSC(=O)CCC(=O)SCC[N+](C)(C)C.[I-].[I-] |
Computed by PubChem (NCBI)