Products 152302-33-5

CAS 152302-33-5 is the registry number for S-20928, 98.63%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg, 10 mg.

Structural formula: {0} (CAS {1})

N-(2-naphthalen-1-ylethyl)cyclobutanecarboxamide (CAS 152302-33-5) is a chemical compound with the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. IUPAC name: N-(2-naphthalen-1-ylethyl)cyclobutanecarboxamide. InChIKey: GLXSBZGTGMPDKH-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19NO
Molecular weight253.34 g/mol
IUPAC nameN-(2-naphthalen-1-ylethyl)cyclobutanecarboxamide
InChIKeyGLXSBZGTGMPDKH-UHFFFAOYSA-N
SMILESC1CC(C1)C(=O)NCCC2=CC=CC3=CC=CC=C32

Computed by PubChem (NCBI)