CAS 152305-87-8 appears in our catalog under these names: 1-Acetyloxy-2,5-dioxopyrrolidine-3-sulfonic acid, 95%, Sulfo-NHS-Acetate, Sulfo–NHS–Acetate, Sulfo-NHS-Acetate 98%, 1-Acetoxy-2,5-dioxopyrrolidine-3-sulfonic acid, 98%, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 1g, 250mg.
1-acetyloxy-2,5-dioxopyrrolidine-3-sulfonic acid (CAS 152305-87-8) is a chemical compound with the molecular formula C6H7NO7S and a molecular weight of 237.19 g/mol. IUPAC name: 1-acetyloxy-2,5-dioxopyrrolidine-3-sulfonic acid. InChIKey: MDUQWFYJHRLNRN-UHFFFAOYSA-N.
| Molecular formula | C6H7NO7S |
|---|---|
| Molecular weight | 237.19 g/mol |
| IUPAC name | 1-acetyloxy-2,5-dioxopyrrolidine-3-sulfonic acid |
| InChIKey | MDUQWFYJHRLNRN-UHFFFAOYSA-N |
| SMILES | CC(=O)ON1C(=O)CC(C1=O)S(=O)(=O)O |
Computed by PubChem (NCBI)