Products 1523196-85-1
CAS 1523196-85-1 appears in our catalog under these names: 2-Bromo-1-[4-bromo-3-(trifluoromethyl)phenyl]ethan-1-one, 95%, 4-Bromo-3-(trifluoromethyl)phenacyl bromide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-bromo-1-[4-bromo-3-(trifluoromethyl)phenyl]ethanone (CAS 1523196-85-1) is a chemical compound with the molecular formula C9H5Br2F3O and a molecular weight of 345.94 g/mol. IUPAC name: 2-bromo-1-[4-bromo-3-(trifluoromethyl)phenyl]ethanone. InChIKey: HTCQEBPXDKYBHT-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2F3O |
|---|---|
| Molecular weight | 345.94 g/mol |
| IUPAC name | 2-bromo-1-[4-bromo-3-(trifluoromethyl)phenyl]ethanone |
| InChIKey | HTCQEBPXDKYBHT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)CBr)C(F)(F)F)Br |
Computed by PubChem (NCBI)