CAS 152329-44-7 is the registry number for (2-NAPHTHYLMETHYL)ZINC BROMIDE, 0.5M. Offered by: Sigma-Aldrich. Available pack sizes: 50ML.
Bromozinc(1+);2-methanidylnaphthalene (CAS 152329-44-7) is a chemical compound with the molecular formula C11H9BrZn and a molecular weight of 286.5 g/mol. IUPAC name: bromozinc(1+);2-methanidylnaphthalene. InChIKey: RZWMNWMGKBGIQX-UHFFFAOYSA-M.
| Molecular formula | C11H9BrZn |
|---|---|
| Molecular weight | 286.5 g/mol |
| IUPAC name | bromozinc(1+);2-methanidylnaphthalene |
| InChIKey | RZWMNWMGKBGIQX-UHFFFAOYSA-M |
| SMILES | [CH2-]C1=CC2=CC=CC=C2C=C1.[Zn+]Br |
Computed by PubChem (NCBI)