CAS 1523530-14-4 is the registry number for (3S,4R)-Piperidine-3,4-diol hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
(3S,4R)-piperidine-3,4-diol;hydrochloride (CAS 1523530-14-4) is a chemical compound with the molecular formula C5H12ClNO2 and a molecular weight of 153.61 g/mol. IUPAC name: (3S,4R)-piperidine-3,4-diol;hydrochloride. InChIKey: DGTFLCBNCAMFON-JBUOLDKXSA-N.
| Molecular formula | C5H12ClNO2 |
|---|---|
| Molecular weight | 153.61 g/mol |
| IUPAC name | (3S,4R)-piperidine-3,4-diol;hydrochloride |
| InChIKey | DGTFLCBNCAMFON-JBUOLDKXSA-N |
| SMILES | C1CNC[C@@H]([C@@H]1O)O.Cl |
Computed by PubChem (NCBI)