CAS 1523530-64-4 appears in our catalog under these names: Exo-3-oxa-9-aza-bicyclo[3.3.1]nonane-7-acetic acid hemioxalate, 95%, 2-(Exo-3-oxa-9-azabicyclo(3.3.1)nonan-7-yl)acetic acid compound with oxalic acid (2:1), 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg, 1g, 5g.
Bis(2-[(1R,5S)-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl]acetic acid);oxalic acid (CAS 1523530-64-4) is a chemical compound with the molecular formula C20H32N2O10 and a molecular weight of 460.5 g/mol. IUPAC name: bis(2-[(1R,5S)-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl]acetic acid);oxalic acid. InChIKey: CAJQDXJNPIRJSX-VUYDLAGASA-N.
| Molecular formula | C20H32N2O10 |
|---|---|
| Molecular weight | 460.5 g/mol |
| IUPAC name | bis(2-[(1R,5S)-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl]acetic acid);oxalic acid |
| InChIKey | CAJQDXJNPIRJSX-VUYDLAGASA-N |
| SMILES | C1[C@@H]2COC[C@@H](N2)CC1CC(=O)O.C1[C@@H]2COC[C@@H](N2)CC1CC(=O)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)