CAS 1523541-81-2 appears in our catalog under these names: ((3R,4S)-3-Fluoropiperidin-4-yl)methanol hydrochloride, 97%, [(3R,4S)-3-fluoro-4-piperidyl]methanol,hydrochloride, 97%, 97%, ((3R,4S)-3-FLUOROPIPERIDIN-4-YL)METHANOL HCL, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg.
[(3R,4S)-3-fluoropiperidin-4-yl]methanol;hydrochloride (CAS 1523541-81-2) is a chemical compound with the molecular formula C6H13ClFNO and a molecular weight of 169.62 g/mol. IUPAC name: [(3R,4S)-3-fluoropiperidin-4-yl]methanol;hydrochloride. InChIKey: ZCJOQWWVTBYQQH-GEMLJDPKSA-N.
| Molecular formula | C6H13ClFNO |
|---|---|
| Molecular weight | 169.62 g/mol |
| IUPAC name | [(3R,4S)-3-fluoropiperidin-4-yl]methanol;hydrochloride |
| InChIKey | ZCJOQWWVTBYQQH-GEMLJDPKSA-N |
| SMILES | C1CNC[C@@H]([C@@H]1CO)F.Cl |
Computed by PubChem (NCBI)