Products 1523606-48-5

CAS 1523606-48-5 is the registry number for 7-thia-2-azaspiro[3.5]nonane hemioxalate, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

Oxalic acid;bis(7-thia-2-azaspiro[3.5]nonane) (CAS 1523606-48-5) is a chemical compound with the molecular formula C16H28N2O4S2 and a molecular weight of 376.5 g/mol. IUPAC name: oxalic acid;bis(7-thia-2-azaspiro[3.5]nonane). InChIKey: FWSZYWBHRALDHJ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H28N2O4S2
Molecular weight376.5 g/mol
IUPAC nameoxalic acid;bis(7-thia-2-azaspiro[3.5]nonane)
InChIKeyFWSZYWBHRALDHJ-UHFFFAOYSA-N
SMILESC1CSCCC12CNC2.C1CSCCC12CNC2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)