CAS 1523617-85-7 appears in our catalog under these names: 5,5-Difluoro-2-azaspiro(3.3)heptane 2,2,2-trifluoroacetate, 98%, 5,5-difluoro-2-azaspiro(3.3)heptane trifluoroacetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
7,7-difluoro-2-azaspiro[3.3]heptane;2,2,2-trifluoroacetic acid (CAS 1523617-85-7) is a chemical compound with the molecular formula C8H10F5NO2 and a molecular weight of 247.16 g/mol. IUPAC name: 7,7-difluoro-2-azaspiro[3.3]heptane;2,2,2-trifluoroacetic acid. InChIKey: CITVMPKPGUBZQE-UHFFFAOYSA-N.
| Molecular formula | C8H10F5NO2 |
|---|---|
| Molecular weight | 247.16 g/mol |
| IUPAC name | 7,7-difluoro-2-azaspiro[3.3]heptane;2,2,2-trifluoroacetic acid |
| InChIKey | CITVMPKPGUBZQE-UHFFFAOYSA-N |
| SMILES | C1CC(C12CNC2)(F)F.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)