CAS 152368-71-3 is the registry number for 4,4′-[[1,1′-Biphenyl]-2,2′-diylbis(oxy)]bis[benzonitrile], 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[2-[2-(4-cyanophenoxy)phenyl]phenoxy]benzonitrile (CAS 152368-71-3) is a chemical compound with the molecular formula C26H16N2O2 and a molecular weight of 388.4 g/mol. IUPAC name: 4-[2-[2-(4-cyanophenoxy)phenyl]phenoxy]benzonitrile. InChIKey: YDXMCMJGSSAUDZ-UHFFFAOYSA-N.
| Molecular formula | C26H16N2O2 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | 4-[2-[2-(4-cyanophenoxy)phenyl]phenoxy]benzonitrile |
| InChIKey | YDXMCMJGSSAUDZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CC=C2OC3=CC=C(C=C3)C#N)OC4=CC=C(C=C4)C#N |
Computed by PubChem (NCBI)