CAS 2368860-32-4 appears in our catalog under these names: 4,4'–(1,10–Phenanthroline–3,8–diyl)dibenzaldehyde, 4,4'-(1,10-Phenanthroline-3,8-diyl)dibenzaldehyde, 98%, 98%, 4,4'-(1,10-Phenanthroline-3,8-diyl)dibenzaldehyde, 98%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
4-[8-(4-formylphenyl)-1,10-phenanthrolin-3-yl]benzaldehyde (CAS 2368860-32-4) is a chemical compound with the molecular formula C26H16N2O2 and a molecular weight of 388.4 g/mol. IUPAC name: 4-[8-(4-formylphenyl)-1,10-phenanthrolin-3-yl]benzaldehyde. InChIKey: AOFZLURFUJSCCT-UHFFFAOYSA-N.
| Molecular formula | C26H16N2O2 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | 4-[8-(4-formylphenyl)-1,10-phenanthrolin-3-yl]benzaldehyde |
| InChIKey | AOFZLURFUJSCCT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CN=C3C(=C2)C=CC4=CC(=CN=C43)C5=CC=C(C=C5)C=O |
Computed by PubChem (NCBI)