CAS 152382-61-1 is the registry number for 3-(Methylthio)-2H-Pyrido(4,3-e)-1,2,4-thiadiazine 1,1-Dioxide. Offered by: TRC. Available pack sizes: 100mg.
3-methylsulfanyl-4H-pyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide (CAS 152382-61-1) is a chemical compound with the molecular formula C7H7N3O2S2 and a molecular weight of 229.3 g/mol. IUPAC name: 3-methylsulfanyl-4H-pyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide. InChIKey: GYKFBZYUKWVXLM-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O2S2 |
|---|---|
| Molecular weight | 229.3 g/mol |
| IUPAC name | 3-methylsulfanyl-4H-pyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide |
| InChIKey | GYKFBZYUKWVXLM-UHFFFAOYSA-N |
| SMILES | CSC1=NS(=O)(=O)C2=C(N1)C=CN=C2 |
Computed by PubChem (NCBI)