CAS 1524245-55-3 appears in our catalog under these names: 2-(4-Amino-3-fluorophenyl)propan-2-ol, 95%, 95%, 2-(4-Amino-3-fluorophenyl)propan-2-ol, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-(4-amino-3-fluorophenyl)propan-2-ol (CAS 1524245-55-3) is a chemical compound with the molecular formula C9H12FNO and a molecular weight of 169.20 g/mol. IUPAC name: 2-(4-amino-3-fluorophenyl)propan-2-ol. InChIKey: CVJLIVXYYCBSCF-UHFFFAOYSA-N.
| Molecular formula | C9H12FNO |
|---|---|
| Molecular weight | 169.20 g/mol |
| IUPAC name | 2-(4-amino-3-fluorophenyl)propan-2-ol |
| InChIKey | CVJLIVXYYCBSCF-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=C(C=C1)N)F)O |
Computed by PubChem (NCBI)