CAS 152463-98-4 is the registry number for Cladribine Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] 4-methylbenzoate (CAS 152463-98-4) is a chemical compound with the molecular formula C18H18ClN5O4 and a molecular weight of 403.8 g/mol. IUPAC name: [(2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] 4-methylbenzoate. InChIKey: KIEIIYCVOLZRQT-YNEHKIRRSA-N.
| Molecular formula | C18H18ClN5O4 |
|---|---|
| Molecular weight | 403.8 g/mol |
| IUPAC name | [(2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] 4-methylbenzoate |
| InChIKey | KIEIIYCVOLZRQT-YNEHKIRRSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)O[C@H]2C[C@@H](O[C@@H]2CO)N3C=NC4=C(N=C(N=C43)Cl)N |
Computed by PubChem (NCBI)