Products 152477-92-4
CAS 152477-92-4 is the registry number for Anhydro Ecgonine-d3. Offered by: TRC. Available pack sizes: 25mg.
(1R,5S)-8-(trideuteriomethyl)-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylic acid (CAS 152477-92-4) is a chemical compound with the molecular formula C9H13NO2 and a molecular weight of 170.22 g/mol. IUPAC name: (1R,5S)-8-(trideuteriomethyl)-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylic acid. InChIKey: HZGRVVUQEIBCMS-BLSVSKBBSA-N.
| Molecular formula | C9H13NO2 |
|---|---|
| Molecular weight | 170.22 g/mol |
| IUPAC name | (1R,5S)-8-(trideuteriomethyl)-8-azabicyclo[3.2.1]oct-2-ene-2-carboxylic acid |
| InChIKey | HZGRVVUQEIBCMS-BLSVSKBBSA-N |
| SMILES | [2H]C([2H])([2H])N1[C@H]2CC[C@@H]1C(=CC2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Anhydro Ecgonine-d3