CAS 152504-10-4 appears in our catalog under these names: Chlorhexidine Digluconate Impurity N Hydrochloride, 98%, Chlorhexidine EP Impurity N, Chlorhexidine Impurity 14 (Chlorhexidine Digluconate EP Impurity N), Chlorhexidine EP Impurity N hydrochloride, Chlorhexidine Digluconate Impurity N-d4. Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(1E)-1-[amino-(4-chloroanilino)methylidene]-2-[6-(diaminomethylideneamino)hexyl]guanidine (CAS 152504-10-4) is a chemical compound with the molecular formula C15H25ClN8 and a molecular weight of 352.86 g/mol. IUPAC name: (1E)-1-[amino-(4-chloroanilino)methylidene]-2-[6-(diaminomethylideneamino)hexyl]guanidine. InChIKey: JSCPTPJOWXCZFC-UHFFFAOYSA-N.
| Molecular formula | C15H25ClN8 |
|---|---|
| Molecular weight | 352.86 g/mol |
| IUPAC name | (1E)-1-[amino-(4-chloroanilino)methylidene]-2-[6-(diaminomethylideneamino)hexyl]guanidine |
| InChIKey | JSCPTPJOWXCZFC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N/C(=N/C(=NCCCCCCN=C(N)N)N)/N)Cl |
Computed by PubChem (NCBI)