CAS 152538-73-3 appears in our catalog under these names: 2,2-Difluoro-2-(2,2,2-trifluoroethoxy)acetic acid, 95%, 2,2-Difluoro-2-(2,2,2-trifluoroethoxy)acetic Acid, 98%, 2,2-Difluoro-2-(2,2,2-trifluoroethoxy)acetic Acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
2,2-difluoro-2-(2,2,2-trifluoroethoxy)acetic acid (CAS 152538-73-3) is a chemical compound with the molecular formula C4H3F5O3 and a molecular weight of 194.06 g/mol. IUPAC name: 2,2-difluoro-2-(2,2,2-trifluoroethoxy)acetic acid. InChIKey: CAARWBUMOXMZKY-UHFFFAOYSA-N.
| Molecular formula | C4H3F5O3 |
|---|---|
| Molecular weight | 194.06 g/mol |
| IUPAC name | 2,2-difluoro-2-(2,2,2-trifluoroethoxy)acetic acid |
| InChIKey | CAARWBUMOXMZKY-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)OC(C(=O)O)(F)F |
Computed by PubChem (NCBI)