CAS 152561-88-1 is the registry number for 2-(3,4-Dimethoxyphenyl)-N-methyl-d3-ethylamine, 99 atom % D, min 97% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
2-(3,4-dimethoxyphenyl)-N-(trideuteriomethyl)ethanamine (CAS 152561-88-1) is a chemical compound with the molecular formula C11H17NO2 and a molecular weight of 198.28 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-N-(trideuteriomethyl)ethanamine. InChIKey: HNJWKRMESUMDQE-FIBGUPNXSA-N.
| Molecular formula | C11H17NO2 |
|---|---|
| Molecular weight | 198.28 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-N-(trideuteriomethyl)ethanamine |
| InChIKey | HNJWKRMESUMDQE-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NCCC1=CC(=C(C=C1)OC)OC |
Computed by PubChem (NCBI)