Products 152564-63-1
CAS 152564-63-1 is the registry number for CGP 55802A. Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium (E)-2-amino-10-[(4-azido-2-hydroxy-3-iodobenzoyl)amino]-4-(phosphonomethyl)dec-3-enoate (CAS 152564-63-1) is a chemical compound with the molecular formula C18H24IN5NaO7P and a molecular weight of 603.3 g/mol. IUPAC name: sodium (E)-2-amino-10-[(4-azido-2-hydroxy-3-iodobenzoyl)amino]-4-(phosphonomethyl)dec-3-enoate. InChIKey: FASKOKIDAZVESF-LBEJWNQZSA-M.
| Molecular formula | C18H24IN5NaO7P |
|---|---|
| Molecular weight | 603.3 g/mol |
| IUPAC name | sodium (E)-2-amino-10-[(4-azido-2-hydroxy-3-iodobenzoyl)amino]-4-(phosphonomethyl)dec-3-enoate |
| InChIKey | FASKOKIDAZVESF-LBEJWNQZSA-M |
| SMILES | C1=CC(=C(C(=C1C(=O)NCCCCCC/C(=C\C(C(=O)[O-])N)/CP(=O)(O)O)O)I)N=[N+]=[N-].[Na+] |
Computed by PubChem (NCBI)