CAS 152612-25-4 is the registry number for (R)-2-ACETAMIDO-3-(THIOPHEN-3-YL)PROPANOIC ACID, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-acetamido-3-thiophen-3-ylpropanoic acid (CAS 152612-25-4) is a chemical compound with the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. IUPAC name: (2R)-2-acetamido-3-thiophen-3-ylpropanoic acid. InChIKey: BAUPSKSGDPNCTJ-MRVPVSSYSA-N.
| Molecular formula | C9H11NO3S |
|---|---|
| Molecular weight | 213.26 g/mol |
| IUPAC name | (2R)-2-acetamido-3-thiophen-3-ylpropanoic acid |
| InChIKey | BAUPSKSGDPNCTJ-MRVPVSSYSA-N |
| SMILES | CC(=O)N[C@H](CC1=CSC=C1)C(=O)O |
Computed by PubChem (NCBI)