CAS 1526200-39-4 is the registry number for 5-(4-Bromo-2,6-difluorophenyl)-1,3,4-thiadiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-(4-bromo-2,6-difluorophenyl)-1,3,4-thiadiazol-2-amine (CAS 1526200-39-4) is a chemical compound with the molecular formula C8H4BrF2N3S and a molecular weight of 292.11 g/mol. IUPAC name: 5-(4-bromo-2,6-difluorophenyl)-1,3,4-thiadiazol-2-amine. InChIKey: WGYVAGDBGZHZHM-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2N3S |
|---|---|
| Molecular weight | 292.11 g/mol |
| IUPAC name | 5-(4-bromo-2,6-difluorophenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | WGYVAGDBGZHZHM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C2=NN=C(S2)N)F)Br |
Computed by PubChem (NCBI)