Products 152624-22-1
CAS 152624-22-1 appears in our catalog under these names: tert-Butyl 2-bromo-4-methylpentanoate, 95%, tert-Butyl 2-bromo-4-methylpentanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
Tert-butyl 2-bromo-4-methylpentanoate (CAS 152624-22-1) is a chemical compound with the molecular formula C10H19BrO2 and a molecular weight of 251.16 g/mol. IUPAC name: tert-butyl 2-bromo-4-methylpentanoate. InChIKey: GUEMBXJPCMQKJW-UHFFFAOYSA-N.
| Molecular formula | C10H19BrO2 |
|---|---|
| Molecular weight | 251.16 g/mol |
| IUPAC name | tert-butyl 2-bromo-4-methylpentanoate |
| InChIKey | GUEMBXJPCMQKJW-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)