CAS 15263-52-2 appears in our catalog under these names: Cartap HCl, Cartap hydrochloride, Cartap Hydrochloride, >95% (HPLC), Cartap hydrochloride, CARTAP HYDROCHLORIDE PESTANAL, 100 MG. Offered by: Chemat Brand, Dr. Ehrenstorfer, TRC, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 250mg, 25mg, 50mg, 25 mg, 100 mg, 50 mg.
S-[3-carbamoylsulfanyl-2-(dimethylamino)propyl] carbamothioate;hydrochloride (CAS 15263-52-2) is a chemical compound with the molecular formula C7H16ClN3O2S2 and a molecular weight of 273.8 g/mol. IUPAC name: S-[3-carbamoylsulfanyl-2-(dimethylamino)propyl] carbamothioate;hydrochloride. InChIKey: MSHXTAQSSIEBQS-UHFFFAOYSA-N.
| Molecular formula | C7H16ClN3O2S2 |
|---|---|
| Molecular weight | 273.8 g/mol |
| IUPAC name | S-[3-carbamoylsulfanyl-2-(dimethylamino)propyl] carbamothioate;hydrochloride |
| InChIKey | MSHXTAQSSIEBQS-UHFFFAOYSA-N |
| SMILES | CN(C)C(CSC(=O)N)CSC(=O)N.Cl |
Computed by PubChem (NCBI)