CAS 152708-24-2 appears in our catalog under these names: Valsartan Impurity 91, 5-(4'-(Azidomethyl)(1,1'-biphenyl)-2-yl)-2H-tetrazole, >95% (HPLC), Des-((S)-3-Methyl-2-pentanamidobutanoic Acid) Valsartan 4’-Azidomethyl, >95% (HPLC), 5–(4'–(Azidomethyl)(1,1'–biphenyl)–2–yl)–2H–tetrazole, 5-(4'-(Azidomethyl)(1,1'-biphenyl)-2-yl)-2H-tetrazole. Offered by: Chemat Brand, TRC, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 10mg, 25mg, 1mg, 5mg.
5-[2-[4-(azidomethyl)phenyl]phenyl]-2H-tetrazole (CAS 152708-24-2) is a chemical compound with the molecular formula C14H11N7 and a molecular weight of 277.28 g/mol. IUPAC name: 5-[2-[4-(azidomethyl)phenyl]phenyl]-2H-tetrazole. InChIKey: HIWODOJPZXUTRT-UHFFFAOYSA-N.
| Molecular formula | C14H11N7 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | 5-[2-[4-(azidomethyl)phenyl]phenyl]-2H-tetrazole |
| InChIKey | HIWODOJPZXUTRT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)CN=[N+]=[N-])C3=NNN=N3 |
Computed by PubChem (NCBI)