CAS 1527479-23-7 appears in our catalog under these names: [4-(Adamantan-1-yl)phenyl]boronic acid, 98%, (4–(Adamantan–1–yl)phenyl)boronic acid, (4-(Adamantan-1-yl)phenyl)boronic acid 98%, [4-(Adamantan-1-yl)phenyl]boronic acid, 98%, 98%, [4-(Adamantan-1-yl)phenyl]boronic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g.
[4-(1-adamantyl)phenyl]boronic acid (CAS 1527479-23-7) is a chemical compound with the molecular formula C16H21BO2 and a molecular weight of 256.1 g/mol. IUPAC name: [4-(1-adamantyl)phenyl]boronic acid. InChIKey: GJRCFNUBCUMANE-UHFFFAOYSA-N.
| Molecular formula | C16H21BO2 |
|---|---|
| Molecular weight | 256.1 g/mol |
| IUPAC name | [4-(1-adamantyl)phenyl]boronic acid |
| InChIKey | GJRCFNUBCUMANE-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C23CC4CC(C2)CC(C4)C3)(O)O |
Computed by PubChem (NCBI)