Products 1527479-23-7
CAS 1527479-23-7 appears in our catalog under these names: [4-(Adamantan-1-yl)phenyl]boronic acid, 98%, (4–(Adamantan–1–yl)phenyl)boronic acid, (4-(Adamantan-1-yl)phenyl)boronic acid, 98%, [4-(Adamantan-1-yl)phenyl]boronic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, BLDpharm, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g, 25g.
[4-(1-adamantyl)phenyl]boronic acid (CAS 1527479-23-7) is a chemical compound with the molecular formula C16H21BO2 and a molecular weight of 256.1 g/mol. IUPAC name: [4-(1-adamantyl)phenyl]boronic acid. InChIKey: GJRCFNUBCUMANE-UHFFFAOYSA-N.
| Molecular formula | C16H21BO2 |
|---|---|
| Molecular weight | 256.1 g/mol |
| IUPAC name | [4-(1-adamantyl)phenyl]boronic acid |
| InChIKey | GJRCFNUBCUMANE-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C23CC4CC(C2)CC(C4)C3)(O)O |
Computed by PubChem (NCBI)
Synonyms:
[4-(Adamantan-1-yl)phenyl]boronic acid, (4-(Adamantan-1-yl)phenyl)boronic acid, [4-(1-adamantyl)phenyl]boronic acid, 4-(1-Adamantyl)phenylboronic acid, 4-(1-Adamantanyl)phenylboronic Acid, (4-(Adamantan-1-yl)phenyl)boronicacid, [4-(Adamantan-1-yl)phenyl]boronic acid - [A92373], B-(4-Tricyclo[3.3.1.13,7]dec-1-ylphenyl)boronic acid, Boronic acid, B-(4-tricyclo[3.3.1.13,7]dec-1-ylphenyl)-, [4-(1-adamantyl)phenyl]boronic acidcontains varying amounts of Anhydride