CAS 1527858-14-5 is the registry number for 2-Amino-3,3,3-trifluoro-N,N,2-trimethylpropanamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-amino-3,3,3-trifluoro-N,N,2-trimethylpropanamide (CAS 1527858-14-5) is a chemical compound with the molecular formula C6H11F3N2O and a molecular weight of 184.16 g/mol. IUPAC name: 2-amino-3,3,3-trifluoro-N,N,2-trimethylpropanamide. InChIKey: JKLONKWXSCHMJL-UHFFFAOYSA-N.
| Molecular formula | C6H11F3N2O |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | 2-amino-3,3,3-trifluoro-N,N,2-trimethylpropanamide |
| InChIKey | JKLONKWXSCHMJL-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N(C)C)(C(F)(F)F)N |
Computed by PubChem (NCBI)