Products 152811-62-6
CAS 152811-62-6 appears in our catalog under these names: Piboserod, Piboserod/ 99.49% (existing batch purity), SB-207266, 98%, 98%, Piboserod, 99.09%, Piboserod (Standard). Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 500mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
N-[(1-butylpiperidin-4-yl)methyl]-3,4-dihydro-2H-[1,3]oxazino[3,2-a]indole-10-carboxamide (CAS 152811-62-6) is a chemical compound with the molecular formula C22H31N3O2 and a molecular weight of 369.5 g/mol. IUPAC name: N-[(1-butylpiperidin-4-yl)methyl]-3,4-dihydro-2H-[1,3]oxazino[3,2-a]indole-10-carboxamide. InChIKey: KVCSJPATKXABRQ-UHFFFAOYSA-N.
| Molecular formula | C22H31N3O2 |
|---|---|
| Molecular weight | 369.5 g/mol |
| IUPAC name | N-[(1-butylpiperidin-4-yl)methyl]-3,4-dihydro-2H-[1,3]oxazino[3,2-a]indole-10-carboxamide |
| InChIKey | KVCSJPATKXABRQ-UHFFFAOYSA-N |
| SMILES | CCCCN1CCC(CC1)CNC(=O)C2=C3N(CCCO3)C4=CC=CC=C42 |
Computed by PubChem (NCBI)