Products 152814-27-2

CAS 152814-27-2 is the registry number for 3-Iodo-n-methylaniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-iodo-N-methylaniline;hydrochloride (CAS 152814-27-2) is a chemical compound with the molecular formula C7H9ClIN and a molecular weight of 269.51 g/mol. IUPAC name: 3-iodo-N-methylaniline;hydrochloride. InChIKey: CXAHPLYJFHOAFS-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9ClIN
Molecular weight269.51 g/mol
IUPAC name3-iodo-N-methylaniline;hydrochloride
InChIKeyCXAHPLYJFHOAFS-UHFFFAOYSA-N
SMILESCNC1=CC(=CC=C1)I.Cl

Computed by PubChem (NCBI)