CAS 152815-28-6 appears in our catalog under these names: RS-25344 hydrochloride/ 99.58% (existing batch purity), RS 25344 hydrochloride, RS 25344 hydrochloride, RS-25344 HCl 98%, RS-25344 (hydrochloride), 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
1-(3-nitrophenyl)-3-(pyridin-4-ylmethyl)pyrido[2,3-d]pyrimidine-2,4-dione;hydrochloride (CAS 152815-28-6) is a chemical compound with the molecular formula C19H14ClN5O4 and a molecular weight of 411.8 g/mol. IUPAC name: 1-(3-nitrophenyl)-3-(pyridin-4-ylmethyl)pyrido[2,3-d]pyrimidine-2,4-dione;hydrochloride. InChIKey: ROSFKXDQMBPYQQ-UHFFFAOYSA-N.
| Molecular formula | C19H14ClN5O4 |
|---|---|
| Molecular weight | 411.8 g/mol |
| IUPAC name | 1-(3-nitrophenyl)-3-(pyridin-4-ylmethyl)pyrido[2,3-d]pyrimidine-2,4-dione;hydrochloride |
| InChIKey | ROSFKXDQMBPYQQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])N2C3=C(C=CC=N3)C(=O)N(C2=O)CC4=CC=NC=C4.Cl |
Computed by PubChem (NCBI)