CAS 15283-51-9 appears in our catalog under these names: Iron(II)tetrafluoroborate, Iron(II) tetrafluoroborate, 45wt.% aqueous solution, 45wt.% aqueous solution. Offered by: GLPBio, Chemat. Available pack sizes: 100g, 25g, 5g, 1g.
Iron(2+) ditetrafluoroborate (CAS 15283-51-9) is a chemical compound with the molecular formula B2F8Fe and a molecular weight of 229.46 g/mol. IUPAC name: iron(2+) ditetrafluoroborate. InChIKey: GXZXLFFLHJJJLX-UHFFFAOYSA-N.
| Molecular formula | B2F8Fe |
|---|---|
| Molecular weight | 229.46 g/mol |
| IUPAC name | iron(2+) ditetrafluoroborate |
| InChIKey | GXZXLFFLHJJJLX-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.[B-](F)(F)(F)F.[Fe+2] |
Computed by PubChem (NCBI)