CAS 1528564-18-2 is the registry number for (S)-1-((R)-2,2-Dichlorocyclopropyl)ethan-1-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-[(1R)-2,2-dichlorocyclopropyl]ethanamine;hydrochloride (CAS 1528564-18-2) is a chemical compound with the molecular formula C5H10Cl3N and a molecular weight of 190.49 g/mol. IUPAC name: (1S)-1-[(1R)-2,2-dichlorocyclopropyl]ethanamine;hydrochloride. InChIKey: JVHRGLXYUAIUIE-RFKZQXLXSA-N.
| Molecular formula | C5H10Cl3N |
|---|---|
| Molecular weight | 190.49 g/mol |
| IUPAC name | (1S)-1-[(1R)-2,2-dichlorocyclopropyl]ethanamine;hydrochloride |
| InChIKey | JVHRGLXYUAIUIE-RFKZQXLXSA-N |
| SMILES | C[C@@H]([C@H]1CC1(Cl)Cl)N.Cl |
Computed by PubChem (NCBI)