CAS 1528793-85-2 is the registry number for (S)-1-((R)-2,2-Dichlorocyclopropyl)ethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-[(1R)-2,2-dichlorocyclopropyl]ethanamine (CAS 1528793-85-2) is a chemical compound with the molecular formula C5H9Cl2N and a molecular weight of 154.03 g/mol. IUPAC name: (1S)-1-[(1R)-2,2-dichlorocyclopropyl]ethanamine. InChIKey: WVRXWJYIBMRGRY-IUYQGCFVSA-N.
| Molecular formula | C5H9Cl2N |
|---|---|
| Molecular weight | 154.03 g/mol |
| IUPAC name | (1S)-1-[(1R)-2,2-dichlorocyclopropyl]ethanamine |
| InChIKey | WVRXWJYIBMRGRY-IUYQGCFVSA-N |
| SMILES | C[C@@H]([C@H]1CC1(Cl)Cl)N |
Computed by PubChem (NCBI)