CAS 15289-56-2 is the registry number for Epalrestat Impurity 27. Offered by: Chemat Brand. Available pack sizes: on request.
(5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 15289-56-2) is a chemical compound with the molecular formula C13H11NOS2 and a molecular weight of 261.4 g/mol. IUPAC name: (5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: YUDRVKDFMJRZMZ-BGZVTZOUSA-N.
| Molecular formula | C13H11NOS2 |
|---|---|
| Molecular weight | 261.4 g/mol |
| IUPAC name | (5Z)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | YUDRVKDFMJRZMZ-BGZVTZOUSA-N |
| SMILES | C/C(=C\C1=CC=CC=C1)/C=C\2/C(=O)NC(=S)S2 |
Computed by PubChem (NCBI)