Products 1528932-52-6
CAS 1528932-52-6 is the registry number for N,N-diethyl-2-fluoro-5-(trifluoromethyl)benzamide, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
N,N-diethyl-2-fluoro-5-(trifluoromethyl)benzamide (CAS 1528932-52-6) is a chemical compound with the molecular formula C12H13F4NO and a molecular weight of 263.23 g/mol. IUPAC name: N,N-diethyl-2-fluoro-5-(trifluoromethyl)benzamide. InChIKey: VFDCKBDEJSEEJV-UHFFFAOYSA-N.
| Molecular formula | C12H13F4NO |
|---|---|
| Molecular weight | 263.23 g/mol |
| IUPAC name | N,N-diethyl-2-fluoro-5-(trifluoromethyl)benzamide |
| InChIKey | VFDCKBDEJSEEJV-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C(C=CC(=C1)C(F)(F)F)F |
Computed by PubChem (NCBI)