CAS 152969-67-0 is the registry number for 2-(4-Fluorophenyl)-5,7-dihydroxy-4H-chromen-4-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-fluorophenyl)-5,7-dihydroxychromen-4-one (CAS 152969-67-0) is a chemical compound with the molecular formula C15H9FO4 and a molecular weight of 272.23 g/mol. IUPAC name: 2-(4-fluorophenyl)-5,7-dihydroxychromen-4-one. InChIKey: XSYORHATJHJUAA-UHFFFAOYSA-N.
| Molecular formula | C15H9FO4 |
|---|---|
| Molecular weight | 272.23 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-5,7-dihydroxychromen-4-one |
| InChIKey | XSYORHATJHJUAA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)F |
Computed by PubChem (NCBI)