CAS 15297-43-5 appears in our catalog under these names: 2-(Tritylthio)ethylamine hydrochloride, 95%, S-Tritylcysteamine Hydrochloride, Trt-Cysteamine*HCl, Trt-cysteamine hydrochloride, 2-(Tritylthio)ethan-1-amine hydrochloride 95% (contains~5.0% water). Offered by: Combi-blocks, TRC, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 5g, 25g, 1g, 10g, 100g, 2g, 250mg.
2-tritylsulfanylethanamine;hydrochloride (CAS 15297-43-5) is a chemical compound with the molecular formula C21H22ClNS and a molecular weight of 355.9 g/mol. IUPAC name: 2-tritylsulfanylethanamine;hydrochloride. InChIKey: SLSXAHLRIYRHBE-UHFFFAOYSA-N.
| Molecular formula | C21H22ClNS |
|---|---|
| Molecular weight | 355.9 g/mol |
| IUPAC name | 2-tritylsulfanylethanamine;hydrochloride |
| InChIKey | SLSXAHLRIYRHBE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)SCCN.Cl |
Computed by PubChem (NCBI)