Products 1529805-29-5
CAS 1529805-29-5 is the registry number for 2-(6-Methylpyridin-2-yl)-5-(trifluoromethyl)isoindoline-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(6-methyl-2-pyridinyl)-5-(trifluoromethyl)isoindole-1,3-dione (CAS 1529805-29-5) is a chemical compound with the molecular formula C15H9F3N2O2 and a molecular weight of 306.24 g/mol. IUPAC name: 2-(6-methyl-2-pyridinyl)-5-(trifluoromethyl)isoindole-1,3-dione. InChIKey: DHGUABOQQFTVGC-UHFFFAOYSA-N.
| Molecular formula | C15H9F3N2O2 |
|---|---|
| Molecular weight | 306.24 g/mol |
| IUPAC name | 2-(6-methyl-2-pyridinyl)-5-(trifluoromethyl)isoindole-1,3-dione |
| InChIKey | DHGUABOQQFTVGC-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)N2C(=O)C3=C(C2=O)C=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)